Karl Fischer Buffers and Reagents
Buffers and reagents intended for use with Karl Fischer (KF) titration techniques. KF titration is a classic titration method that uses coulometric or volumetric titration to determine the moisture content of a sample.
Karl Fischer (KF) reagents are used in the analytical technique developed by chemist Karl Fischer to accurately measure the water content of gases, liquids, and solids.
Key applications include:
- Analyzing water content in raw materials and finished products
- Estimating moisture in food, pharmaceuticals, chemicals, and petroleum products
- Determining the water content of laboratory samples.
Karl Fischer reagents contain a variety of chemicals in proprietary formulations. Consult the SDS for individual products for appropriate handling instructions and precautions.
![eMolecules 944937-14-8 | 1-{1H-pyrrolo[2,3-b]pyridin-5-yl}ethan-1-one | Pharmablock | MFCD09266225 | 160.176 | C9H8N2O | 97.000 | CC(=O)c1cnc2[nH]ccc2c1 | 25mg | 551060869](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502440556.PNG-250.jpg)
eMolecules 944937-14-8 | 1-{1H-pyrrolo[2,3-b]pyridin-5-yl}ethan-1-one | Pharmablock | MFCD09266225 | 160.176 | C9H8N2O | 97.000 | CC(=O)c1cnc2[nH]ccc2c1 | 25mg | 551060869
1-{1H-pyrrolo[2,3-b]pyridin-5-yl}ethan-1-one | Pharmablock | 944937-14-8 | MFCD09266225 | 160.176 | C9H8N2O | 97.000 | CC(=O)c1cnc2[nH]ccc2c1 | 25mg | 551060869
eMolecules 1021306-45-5 | Ambeed | 2-(4455-Tetramethyl-132-dioxaborolan-2-yl)-9H-fluoren-9-one | 250mg | 696731920 | A334841 | MFCD16294551 | 306.17 | C19H19BO3
Medchem Express | Telotristat ethyl | 5mg | 446262342 | HY-13055A | 1033805-22-9 | MFCD18251583 | 574.990 | C27H26ClF3N6O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 286442-89-5 | 1-methyl-3-oxocyclobutane-1-carboxylic acid | Pharmablock | MFCD00604210 | 128.127 | C6H8O3 | 97.000 | CC1(CC(=O)C1)C(O)=O | 25mg | 586148437
1-methyl-3-oxocyclobutane-1-carboxylic acid | Pharmablock | 286442-89-5 | MFCD00604210 | 128.127 | C6H8O3 | 97.000 | CC1(CC(=O)C1)C(O)=O | 25mg | 586148437
eMolecules 1221239-08-2 | Ambeed | 4-(4455-Tetramethyl-132-dioxaborolan-2-yl)-23-dihydro-1H-inden-1-one | 100mg | 642079697 | A1159188 | MFCD16140217 | 258.12 | C15H19BO3
Pharmablock | methyl 2-(hydroxymethyl)cyclopropanecarboxylate | 25mg | 718384151 | PBDL740 | 13482-81-0 | MFCD28642901 | 130.143 | C6H10O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 352525-99-6 | Ambeed | (5-Propionylthiophen-2-yl)boronic acid | 100mg | 686660357 | A791245 | MFCD18968535 | 184.02 | C7H9BO3S
ChemScene | (R)-1-(p-Tolyl)propan-1-amine hydrochloride | 100mg | 714104422 | CS-0188455 | 856646-02-1 | MFCD12910560 | 185.700 | C10H16ClN
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 128-57-4 | Sennoside B | Ambeed | MFCD00151528 | 862.746 | C42H38O20 | 98.000 | OC[C@H]1O[C@@H](Oc2cccc3[C@H]([C@@H]4c5cccc(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)c5C(=O)c5c(O)cc(cc45)C(O)=O)c4cc(cc(O)c4C(=O)c23)C(O)=O)[C@H](O)[C@@H](O)[C@@H]1O | 1mg | 682928048](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502431040.PNG-250.jpg)
eMolecules 128-57-4 | Sennoside B | Ambeed | MFCD00151528 | 862.746 | C42H38O20 | 98.000 | OC[C@H]1O[C@@H](Oc2cccc3[C@H]([C@@H]4c5cccc(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)c5C(=O)c5c(O)cc(cc45)C(O)=O)c4cc(cc(O)c4C(=O)c23)C(O)=O)[C@H](O)[C@@H](O)[C@@H]1O | 1mg | 682928048
Sennoside B | Ambeed | 128-57-4 | MFCD00151528 | 862.746 | C42H38O20 | 98.000 | OC[C@H]1O[C@@H](Oc2cccc3[C@H]([C@@H]4c5cccc(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)c5C(=O)c5c(O)cc(cc45)C(O)=O)c4cc(cc(O)c4C(=O)c23)C(O)=O)[C@H](O)[C@@H](O)[C@@H]1O | 1mg | 682928048
![eMolecules 1794756-24-3 | 1-(METHYL-D3)PIPERIDIN-4-ONE | AstaTech116.178 | C6H11NO | 95.000 | [2H]C([2H])([2H])N1CCC(=O)CC1 | 0.1g | 575799901](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502476055.JPG-250.jpg)
eMolecules 1794756-24-3 | 1-(METHYL-D3)PIPERIDIN-4-ONE | AstaTech116.178 | C6H11NO | 95.000 | [2H]C([2H])([2H])N1CCC(=O)CC1 | 0.1g | 575799901
1-(METHYL-D3)PIPERIDIN-4-ONE | AstaTech | 1794756-24-3116.178 | C6H11NO | 95.000 | [2H]C([2H])([2H])N1CCC(=O)CC1 | 0.1g | 575799901